C22H18ClNO3 — CID 72945603
6-(4-chlorophenoxy)-2-[4-(2-methoxyethyl)phenyl]-1,3-benzoxazole (PubChem CID 72945603) has the molecular formula C22H18ClNO3 and a molecular weight of 379.84 g/mol. Its IUPAC name is 6-(4-chlorophenoxy)-2-[4-(2-methoxyethyl)phenyl]-1,3-benzoxazole.
| Compound Name | 6-(4-chlorophenoxy)-2-[4-(2-methoxyethyl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 72945603 |
| Molecular Formula | C22H18ClNO3 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 6-(4-chlorophenoxy)-2-[4-(2-methoxyethyl)phenyl]-1,3-benzoxazole |
| SMILES | COCCc1ccc(-c2nc3ccc(Oc4ccc(Cl)cc4)cc3o2)cc1 |
| InChI | InChI=1S/C22H18ClNO3/c1-25-13-12-15-2-4-16(5-3-15)22-24-20-11-10-19(14-21(20)27-22)26-18-8-6-17(23)7-9-18/h2-11,14H,12-13H2,1H3 |
| InChIKey | MEEDHWJJCMSHKO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |