C26H25ClN2O3 — CID 72945974
6-(4-chlorophenoxy)-2-[4-(3-morpholin-4-ylpropyl)phenyl]-1,3-benzoxazole (PubChem CID 72945974) has the molecular formula C26H25ClN2O3 and a molecular weight of 448.95 g/mol. Its IUPAC name is 6-(4-chlorophenoxy)-2-[4-(3-morpholin-4-ylpropyl)phenyl]-1,3-benzoxazole.
| Compound Name | 6-(4-chlorophenoxy)-2-[4-(3-morpholin-4-ylpropyl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 72945974 |
| Molecular Formula | C26H25ClN2O3 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 6-(4-chlorophenoxy)-2-[4-(3-morpholin-4-ylpropyl)phenyl]-1,3-benzoxazole |
| SMILES | Clc1ccc(Oc2ccc3nc(-c4ccc(CCCN5CCOCC5)cc4)oc3c2)cc1 |
| InChI | InChI=1S/C26H25ClN2O3/c27-21-7-9-22(10-8-21)31-23-11-12-24-25(18-23)32-26(28-24)20-5-3-19(4-6-20)2-1-13-29-14-16-30-17-15-29/h3-12,18H,1-2,13-17H2 |
| InChIKey | TWFVZXYNQPPXIG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |