C21H15ClN4O2 — CID 142715897
2-[4-(2-azidoethyl)phenyl]-6-(4-chlorophenoxy)-1,3-benzoxazole (PubChem CID 142715897) has the molecular formula C21H15ClN4O2 and a molecular weight of 390.83 g/mol. Its IUPAC name is 2-[4-(2-azidoethyl)phenyl]-6-(4-chlorophenoxy)-1,3-benzoxazole.
| Compound Name | 2-[4-(2-azidoethyl)phenyl]-6-(4-chlorophenoxy)-1,3-benzoxazole |
|---|---|
| PubChem CID | 142715897 |
| Molecular Formula | C21H15ClN4O2 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-[4-(2-azidoethyl)phenyl]-6-(4-chlorophenoxy)-1,3-benzoxazole |
| SMILES | [N-]=[N+]=NCCc1ccc(-c2nc3ccc(Oc4ccc(Cl)cc4)cc3o2)cc1 |
| InChI | InChI=1S/C21H15ClN4O2/c22-16-5-7-17(8-6-16)27-18-9-10-19-20(13-18)28-21(25-19)15-3-1-14(2-4-15)11-12-24-26-23/h1-10,13H,11-12H2 |
| InChIKey | PNPGMTCMDOZWKY-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|