C22H17Cl2NO3 — CID 142715895
6-(4-chlorophenoxy)-2-[4-(3-chloropropoxy)phenyl]-1,3-benzoxazole (PubChem CID 142715895) has the molecular formula C22H17Cl2NO3 and a molecular weight of 414.29 g/mol. Its IUPAC name is 6-(4-chlorophenoxy)-2-[4-(3-chloropropoxy)phenyl]-1,3-benzoxazole.
| Compound Name | 6-(4-chlorophenoxy)-2-[4-(3-chloropropoxy)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 142715895 |
| Molecular Formula | C22H17Cl2NO3 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 6-(4-chlorophenoxy)-2-[4-(3-chloropropoxy)phenyl]-1,3-benzoxazole |
| SMILES | ClCCCOc1ccc(-c2nc3ccc(Oc4ccc(Cl)cc4)cc3o2)cc1 |
| InChI | InChI=1S/C22H17Cl2NO3/c23-12-1-13-26-17-6-2-15(3-7-17)22-25-20-11-10-19(14-21(20)28-22)27-18-8-4-16(24)5-9-18/h2-11,14H,1,12-13H2 |
| InChIKey | ZPDHYAVLBZSLRQ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|