C17H18N2O2 — CID 129018379
4-(6-butoxy-1,3-benzoxazol-2-yl)aniline (PubChem CID 129018379) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-(6-butoxy-1,3-benzoxazol-2-yl)aniline.
| Compound Name | 4-(6-butoxy-1,3-benzoxazol-2-yl)aniline |
|---|---|
| PubChem CID | 129018379 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-(6-butoxy-1,3-benzoxazol-2-yl)aniline |
| SMILES | CCCCOc1ccc2nc(-c3ccc(N)cc3)oc2c1 |
| InChI | InChI=1S/C17H18N2O2/c1-2-3-10-20-14-8-9-15-16(11-14)21-17(19-15)12-4-6-13(18)7-5-12/h4-9,11H,2-3,10,18H2,1H3 |
| InChIKey | QNNNJHMXBVAEEH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|