C16H15NO3 — CID 117098273
3-[(2-phenyl-1,3-benzoxazol-6-yl)oxy]propan-1-ol (PubChem CID 117098273) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-[(2-phenyl-1,3-benzoxazol-6-yl)oxy]propan-1-ol.
| Compound Name | 3-[(2-phenyl-1,3-benzoxazol-6-yl)oxy]propan-1-ol |
|---|---|
| PubChem CID | 117098273 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 3-[(2-phenyl-1,3-benzoxazol-6-yl)oxy]propan-1-ol |
| SMILES | OCCCOc1ccc2nc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C16H15NO3/c18-9-4-10-19-13-7-8-14-15(11-13)20-16(17-14)12-5-2-1-3-6-12/h1-3,5-8,11,18H,4,9-10H2 |
| InChIKey | LATBCUMWHVNNGA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|