C20H11F2NO3 — CID 110494685
(2-phenyl-1,3-benzoxazol-6-yl) 2,5-difluorobenzoate (PubChem CID 110494685) has the molecular formula C20H11F2NO3 and a molecular weight of 351.31 g/mol. Its IUPAC name is (2-phenyl-1,3-benzoxazol-6-yl) 2,5-difluorobenzoate.
| Compound Name | (2-phenyl-1,3-benzoxazol-6-yl) 2,5-difluorobenzoate |
|---|---|
| PubChem CID | 110494685 |
| Molecular Formula | C20H11F2NO3 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (2-phenyl-1,3-benzoxazol-6-yl) 2,5-difluorobenzoate |
| SMILES | O=C(Oc1ccc2nc(-c3ccccc3)oc2c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C20H11F2NO3/c21-13-6-8-16(22)15(10-13)20(24)25-14-7-9-17-18(11-14)26-19(23-17)12-4-2-1-3-5-12/h1-11H |
| InChIKey | IVHKZBFCPOFHIE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|