About carbonyl difluoride;2-phenyl-1,3-benzoxazole
carbonyl difluoride;2-phenyl-1,3-benzoxazole (PubChem CID 158063385) has the molecular formula C14H9F2NO2
and a molecular weight of 261.23 g/mol. Its IUPAC name is carbonyl difluoride;2-phenyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | carbonyl difluoride;2-phenyl-1,3-benzoxazole |
| PubChem CID | 158063385 |
| Molecular Formula | C14H9F2NO2 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | carbonyl difluoride;2-phenyl-1,3-benzoxazole |
| SMILES | O=C(F)F.c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C13H9NO.CF2O/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;2-1(3)4/h1-9H; |
| InChIKey | FKXSYLVRMHCUML-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze carbonyl difluoride;2-phenyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonyl difluoride;2-phenyl-1,3-benzoxazole?
The IUPAC name of carbonyl difluoride;2-phenyl-1,3-benzoxazole (CID 158063385) is carbonyl difluoride;2-phenyl-1,3-benzoxazole.
What is the SMILES notation for carbonyl difluoride;2-phenyl-1,3-benzoxazole?
The canonical SMILES for carbonyl difluoride;2-phenyl-1,3-benzoxazole is O=C(F)F.c1ccc(-c2nc3ccccc3o2)cc1.
What is the InChIKey of carbonyl difluoride;2-phenyl-1,3-benzoxazole?
The InChIKey is FKXSYLVRMHCUML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO.CF2O/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;2-1(3)4/h1-9H;.
What are the key properties of carbonyl difluoride;2-phenyl-1,3-benzoxazole?
carbonyl difluoride;2-phenyl-1,3-benzoxazole has a molecular weight of 261.23 g/mol, XLogP of 4.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonyl difluoride;2-phenyl-1,3-benzoxazole is sourced from PubChem (CID 158063385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).