C20H12N2O3 — CID 17341213
3,5-bis(1,3-benzoxazol-2-yl)phenol (PubChem CID 17341213) has the molecular formula C20H12N2O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is 3,5-bis(1,3-benzoxazol-2-yl)phenol.
| Compound Name | 3,5-bis(1,3-benzoxazol-2-yl)phenol |
|---|---|
| PubChem CID | 17341213 |
| Molecular Formula | C20H12N2O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 3,5-bis(1,3-benzoxazol-2-yl)phenol |
| SMILES | Oc1cc(-c2nc3ccccc3o2)cc(-c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C20H12N2O3/c23-14-10-12(19-21-15-5-1-3-7-17(15)24-19)9-13(11-14)20-22-16-6-2-4-8-18(16)25-20/h1-11,23H |
| InChIKey | RJZREZCQLWCWCG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |