C15H13NO4 — CID 135784125
4-(1,3-benzoxazol-2-yl)-2,6-bis(hydroxymethyl)phenol (PubChem CID 135784125) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-2,6-bis(hydroxymethyl)phenol.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-2,6-bis(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 135784125 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-2,6-bis(hydroxymethyl)phenol |
| SMILES | OCc1cc(-c2nc3ccccc3o2)cc(CO)c1O |
| InChI | InChI=1S/C15H13NO4/c17-7-10-5-9(6-11(8-18)14(10)19)15-16-12-3-1-2-4-13(12)20-15/h1-6,17-19H,7-8H2 |
| InChIKey | USWYLKCCXOZOEY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |