C26H19NO3 — CID 58057288
[4-[4-[4-(1,3-benzoxazol-2-yl)phenyl]phenoxy]phenyl]methanol (PubChem CID 58057288) has the molecular formula C26H19NO3 and a molecular weight of 393.44 g/mol. Its IUPAC name is [4-[4-[4-(1,3-benzoxazol-2-yl)phenyl]phenoxy]phenyl]methanol.
| Compound Name | [4-[4-[4-(1,3-benzoxazol-2-yl)phenyl]phenoxy]phenyl]methanol |
|---|---|
| PubChem CID | 58057288 |
| Molecular Formula | C26H19NO3 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [4-[4-[4-(1,3-benzoxazol-2-yl)phenyl]phenoxy]phenyl]methanol |
| SMILES | OCc1ccc(Oc2ccc(-c3ccc(-c4nc5ccccc5o4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H19NO3/c28-17-18-5-13-22(14-6-18)29-23-15-11-20(12-16-23)19-7-9-21(10-8-19)26-27-24-3-1-2-4-25(24)30-26/h1-16,28H,17H2 |
| InChIKey | ZGYCJINJSQUYRF-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |