C22H17NO5 — CID 127045111
[4-(1,3-benzoxazol-2-yl)phenyl]methyl 2-(3,4-dihydroxyphenyl)acetate (PubChem CID 127045111) has the molecular formula C22H17NO5 and a molecular weight of 375.38 g/mol. Its IUPAC name is [4-(1,3-benzoxazol-2-yl)phenyl]methyl 2-(3,4-dihydroxyphenyl)acetate.
| Compound Name | [4-(1,3-benzoxazol-2-yl)phenyl]methyl 2-(3,4-dihydroxyphenyl)acetate |
|---|---|
| PubChem CID | 127045111 |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [4-(1,3-benzoxazol-2-yl)phenyl]methyl 2-(3,4-dihydroxyphenyl)acetate |
| SMILES | O=C(Cc1ccc(O)c(O)c1)OCc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C22H17NO5/c24-18-10-7-15(11-19(18)25)12-21(26)27-13-14-5-8-16(9-6-14)22-23-17-3-1-2-4-20(17)28-22/h1-11,24-25H,12-13H2 |
| InChIKey | YKKBXMBXOXFDLC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|