C22H16N2O4 — CID 41107745
2-(1,3-benzodioxol-5-yl)-N-[4-(1,3-benzoxazol-2-yl)phenyl]acetamide (PubChem CID 41107745) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[4-(1,3-benzoxazol-2-yl)phenyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[4-(1,3-benzoxazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 41107745 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[4-(1,3-benzoxazol-2-yl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)Nc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C22H16N2O4/c25-21(12-14-5-10-19-20(11-14)27-13-26-19)23-16-8-6-15(7-9-16)22-24-17-3-1-2-4-18(17)28-22/h1-11H,12-13H2,(H,23,25) |
| InChIKey | NRKAAMUWFFONSD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |