C21H14Cl2N2O2 — CID 18225429
N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-(2,4-dichlorophenyl)acetamide (PubChem CID 18225429) has the molecular formula C21H14Cl2N2O2 and a molecular weight of 397.26 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-(2,4-dichlorophenyl)acetamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 18225429 |
| Molecular Formula | C21H14Cl2N2O2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-(2,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)Nc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C21H14Cl2N2O2/c22-15-8-5-14(17(23)12-15)11-20(26)24-16-9-6-13(7-10-16)21-25-18-3-1-2-4-19(18)27-21/h1-10,12H,11H2,(H,24,26) |
| InChIKey | JGQKUAZMVDMVGS-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |