About (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate
(4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate (PubChem CID 163230339) has the molecular formula C26H18N2O5
and a molecular weight of 438.44 g/mol. Its IUPAC name is (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate.
Molecular Properties
| Compound Name | (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate |
| PubChem CID | 163230339 |
| Molecular Formula | C26H18N2O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate |
| SMILES | O=Cc1ccc(COC(=O)Nc2ccc3cc(-c4nc5ccccc5o4)ccc3c2)cc1O |
| InChI | InChI=1S/C26H18N2O5/c29-14-20-6-5-16(11-23(20)30)15-32-26(31)27-21-10-9-17-12-19(8-7-18(17)13-21)25-28-22-3-1-2-4-24(22)33-25/h1-14,30H,15H2,(H,27,31) |
| InChIKey | HYHORYMPCSLBLE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate?
The IUPAC name of (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate (CID 163230339) is (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate.
What is the SMILES notation for (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate?
The canonical SMILES for (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate is O=Cc1ccc(COC(=O)Nc2ccc3cc(-c4nc5ccccc5o4)ccc3c2)cc1O.
What is the InChIKey of (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate?
The InChIKey is HYHORYMPCSLBLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18N2O5/c29-14-20-6-5-16(11-23(20)30)15-32-26(31)27-21-10-9-17-12-19(8-7-18(17)13-21)25-28-22-3-1-2-4-24(22)33-25/h1-14,30H,15H2,(H,27,31).
What are the key properties of (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate?
(4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate has a molecular weight of 438.44 g/mol, XLogP of 5.91, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formyl-3-hydroxyphenyl)methyl N-[6-(1,3-benzoxazol-2-yl)naphthalen-2-yl]carbamate is sourced from PubChem (CID 163230339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).