C23H16N2O3 — CID 110828616
1-(1-benzofuran-2-yl)-2-[4-(1,3-benzoxazol-2-yl)anilino]ethanone (PubChem CID 110828616) has the molecular formula C23H16N2O3 and a molecular weight of 368.39 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-[4-(1,3-benzoxazol-2-yl)anilino]ethanone.
| Compound Name | 1-(1-benzofuran-2-yl)-2-[4-(1,3-benzoxazol-2-yl)anilino]ethanone |
|---|---|
| PubChem CID | 110828616 |
| Molecular Formula | C23H16N2O3 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-[4-(1,3-benzoxazol-2-yl)anilino]ethanone |
| SMILES | O=C(CNc1ccc(-c2nc3ccccc3o2)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H16N2O3/c26-19(22-13-16-5-1-3-7-20(16)27-22)14-24-17-11-9-15(10-12-17)23-25-18-6-2-4-8-21(18)28-23/h1-13,24H,14H2 |
| InChIKey | CDBQMOKUFPTZMO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |