C16H11Cl2NO2 — CID 110824293
1-(1-benzofuran-2-yl)-2-(3,4-dichloroanilino)ethanone (PubChem CID 110824293) has the molecular formula C16H11Cl2NO2 and a molecular weight of 320.18 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-(3,4-dichloroanilino)ethanone.
| Compound Name | 1-(1-benzofuran-2-yl)-2-(3,4-dichloroanilino)ethanone |
|---|---|
| PubChem CID | 110824293 |
| Molecular Formula | C16H11Cl2NO2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-(3,4-dichloroanilino)ethanone |
| SMILES | O=C(CNc1ccc(Cl)c(Cl)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H11Cl2NO2/c17-12-6-5-11(8-13(12)18)19-9-14(20)16-7-10-3-1-2-4-15(10)21-16/h1-8,19H,9H2 |
| InChIKey | BKAPSOHOWCLZGV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |