C16H10Cl2O2 — CID 107307868
1-(1-benzofuran-2-yl)-2-(2,3-dichlorophenyl)ethanone (PubChem CID 107307868) has the molecular formula C16H10Cl2O2 and a molecular weight of 305.16 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-(2,3-dichlorophenyl)ethanone.
| Compound Name | 1-(1-benzofuran-2-yl)-2-(2,3-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 107307868 |
| Molecular Formula | C16H10Cl2O2 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-(2,3-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(Cl)c1Cl)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H10Cl2O2/c17-12-6-3-5-11(16(12)18)8-13(19)15-9-10-4-1-2-7-14(10)20-15/h1-7,9H,8H2 |
| InChIKey | PKQFOIYQSYSRII-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |