C21H18Cl2N2O3 — CID 86903574
3-[4-[(2,3-dichlorophenyl)methyl]piperazine-1-carbonyl]chromen-2-one (PubChem CID 86903574) has the molecular formula C21H18Cl2N2O3 and a molecular weight of 417.29 g/mol. Its IUPAC name is 3-[4-[(2,3-dichlorophenyl)methyl]piperazine-1-carbonyl]chromen-2-one.
| Compound Name | 3-[4-[(2,3-dichlorophenyl)methyl]piperazine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 86903574 |
| Molecular Formula | C21H18Cl2N2O3 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 3-[4-[(2,3-dichlorophenyl)methyl]piperazine-1-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCN(Cc2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C21H18Cl2N2O3/c22-17-6-3-5-15(19(17)23)13-24-8-10-25(11-9-24)20(26)16-12-14-4-1-2-7-18(14)28-21(16)27/h1-7,12H,8-11,13H2 |
| InChIKey | BDPWITHLJDSJDA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|