C25H20N2O6 — CID 1224770
3-[4-(2-oxochromene-3-carbonyl)-1,4-diazepane-1-carbonyl]chromen-2-one (PubChem CID 1224770) has the molecular formula C25H20N2O6 and a molecular weight of 444.44 g/mol. Its IUPAC name is 3-[4-(2-oxochromene-3-carbonyl)-1,4-diazepane-1-carbonyl]chromen-2-one.
| Compound Name | 3-[4-(2-oxochromene-3-carbonyl)-1,4-diazepane-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 1224770 |
| Molecular Formula | C25H20N2O6 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 3-[4-(2-oxochromene-3-carbonyl)-1,4-diazepane-1-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCCN(C(=O)c2cc3ccccc3oc2=O)CC1 |
| InChI | InChI=1S/C25H20N2O6/c28-22(18-14-16-6-1-3-8-20(16)32-24(18)30)26-10-5-11-27(13-12-26)23(29)19-15-17-7-2-4-9-21(17)33-25(19)31/h1-4,6-9,14-15H,5,10-13H2 |
| InChIKey | HFLGYOOFGXUPKF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 101.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|