C23H25N5O3 — CID 70703025
3-[4-(2-piperidin-1-ylpyrimidin-4-yl)piperazine-1-carbonyl]chromen-2-one (PubChem CID 70703025) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 3-[4-(2-piperidin-1-ylpyrimidin-4-yl)piperazine-1-carbonyl]chromen-2-one.
| Compound Name | 3-[4-(2-piperidin-1-ylpyrimidin-4-yl)piperazine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 70703025 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 3-[4-(2-piperidin-1-ylpyrimidin-4-yl)piperazine-1-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCN(c2ccnc(N3CCCCC3)n2)CC1 |
| InChI | InChI=1S/C23H25N5O3/c29-21(18-16-17-6-2-3-7-19(17)31-22(18)30)27-14-12-26(13-15-27)20-8-9-24-23(25-20)28-10-4-1-5-11-28/h2-3,6-9,16H,1,4-5,10-15H2 |
| InChIKey | UDBTXFDSHKOEPX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|