C16H17NO3 — CID 716526
3-(azepane-1-carbonyl)chromen-2-one (PubChem CID 716526) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-(azepane-1-carbonyl)chromen-2-one.
| Compound Name | 3-(azepane-1-carbonyl)chromen-2-one |
|---|---|
| PubChem CID | 716526 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-(azepane-1-carbonyl)chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCCCCC1 |
| InChI | InChI=1S/C16H17NO3/c18-15(17-9-5-1-2-6-10-17)13-11-12-7-3-4-8-14(12)20-16(13)19/h3-4,7-8,11H,1-2,5-6,9-10H2 |
| InChIKey | QEUJLHFRRGJOQZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|