C19H20N2O4 — CID 94352979
(3R)-N-cyclopropyl-1-(2-oxochromene-3-carbonyl)piperidine-3-carboxamide (PubChem CID 94352979) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (3R)-N-cyclopropyl-1-(2-oxochromene-3-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-cyclopropyl-1-(2-oxochromene-3-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94352979 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (3R)-N-cyclopropyl-1-(2-oxochromene-3-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CC1)[C@@H]1CCCN(C(=O)c2cc3ccccc3oc2=O)C1 |
| InChI | InChI=1S/C19H20N2O4/c22-17(20-14-7-8-14)13-5-3-9-21(11-13)18(23)15-10-12-4-1-2-6-16(12)25-19(15)24/h1-2,4,6,10,13-14H,3,5,7-9,11H2,(H,20,22)/t13-/m1/s1 |
| InChIKey | OGIACUYTWZKKEM-CYBMUJFWSA-N |
| XLogP | 1.92 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|