C15H15NO4 — CID 62372877
3-[3-(hydroxymethyl)pyrrolidine-1-carbonyl]chromen-2-one (PubChem CID 62372877) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)pyrrolidine-1-carbonyl]chromen-2-one.
| Compound Name | 3-[3-(hydroxymethyl)pyrrolidine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 62372877 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-[3-(hydroxymethyl)pyrrolidine-1-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCC(CO)C1 |
| InChI | InChI=1S/C15H15NO4/c17-9-10-5-6-16(8-10)14(18)12-7-11-3-1-2-4-13(11)20-15(12)19/h1-4,7,10,17H,5-6,8-9H2 |
| InChIKey | SHVFGGRLYLZDTK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|