C16H17NO4 — CID 78919420
methyl (3S)-1-(1-benzofuran-2-carbonyl)piperidine-3-carboxylate (PubChem CID 78919420) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is methyl (3S)-1-(1-benzofuran-2-carbonyl)piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-(1-benzofuran-2-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78919420 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | methyl (3S)-1-(1-benzofuran-2-carbonyl)piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(C(=O)c2cc3ccccc3o2)C1 |
| InChI | InChI=1S/C16H17NO4/c1-20-16(19)12-6-4-8-17(10-12)15(18)14-9-11-5-2-3-7-13(11)21-14/h2-3,5,7,9,12H,4,6,8,10H2,1H3/t12-/m0/s1 |
| InChIKey | JPSHMUGXCGSVBU-LBPRGKRZSA-N |
| XLogP | 2.46 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |