C18H19NO6 — CID 7193669
methyl 1-[2-(1-benzofuran-2-carbonyloxy)acetyl]piperidine-4-carboxylate (PubChem CID 7193669) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is methyl 1-[2-(1-benzofuran-2-carbonyloxy)acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(1-benzofuran-2-carbonyloxy)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7193669 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | methyl 1-[2-(1-benzofuran-2-carbonyloxy)acetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)COC(=O)c2cc3ccccc3o2)CC1 |
| InChI | InChI=1S/C18H19NO6/c1-23-17(21)12-6-8-19(9-7-12)16(20)11-24-18(22)15-10-13-4-2-3-5-14(13)25-15/h2-5,10,12H,6-9,11H2,1H3 |
| InChIKey | CRFMHIQXWVHXIE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |