C19H22N4O5 — CID 55640680
methyl 1-[2-(1-benzyltriazole-4-carbonyl)oxyacetyl]piperidine-4-carboxylate (PubChem CID 55640680) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is methyl 1-[2-(1-benzyltriazole-4-carbonyl)oxyacetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(1-benzyltriazole-4-carbonyl)oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55640680 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | methyl 1-[2-(1-benzyltriazole-4-carbonyl)oxyacetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)COC(=O)c2cn(Cc3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C19H22N4O5/c1-27-18(25)15-7-9-22(10-8-15)17(24)13-28-19(26)16-12-23(21-20-16)11-14-5-3-2-4-6-14/h2-6,12,15H,7-11,13H2,1H3 |
| InChIKey | LNNUGXKFGOSHGJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |