C19H24N4O3 — CID 55516705
[2-(cyclohexylmethylamino)-2-oxoethyl] 1-benzyltriazole-4-carboxylate (PubChem CID 55516705) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 1-benzyltriazole-4-carboxylate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 55516705 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
| SMILES | O=C(COC(=O)c1cn(Cc2ccccc2)nn1)NCC1CCCCC1 |
| InChI | InChI=1S/C19H24N4O3/c24-18(20-11-15-7-3-1-4-8-15)14-26-19(25)17-13-23(22-21-17)12-16-9-5-2-6-10-16/h2,5-6,9-10,13,15H,1,3-4,7-8,11-12,14H2,(H,20,24) |
| InChIKey | IBLUWKCDCCOWLY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |