C13H13N3O3 — CID 55640927
2-oxopropyl 1-benzyltriazole-4-carboxylate (PubChem CID 55640927) has the molecular formula C13H13N3O3 and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-oxopropyl 1-benzyltriazole-4-carboxylate.
| Compound Name | 2-oxopropyl 1-benzyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 55640927 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-oxopropyl 1-benzyltriazole-4-carboxylate |
| SMILES | CC(=O)COC(=O)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C13H13N3O3/c1-10(17)9-19-13(18)12-8-16(15-14-12)7-11-5-3-2-4-6-11/h2-6,8H,7,9H2,1H3 |
| InChIKey | HKLSCEBYFZFIMU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |