2-oxopropyl 1-benzyltriazole-4-carboxylate

C13H13N3O3 — CID 55640927

IUPAC2-oxopropyl 1-benzyltriazole-4-carboxylate
SMILESCC(=O)COC(=O)c1cn(Cc2ccccc2)nn1
InChIInChI=1S/C13H13N3O3/c1-10(17)9-19-13(18)12-8-16(15-14-12)7-11-5-3-2-4-6-11/h2-6,8H,7,9H2,1H3
InChIKeyHKLSCEBYFZFIMU-UHFFFAOYSA-N
MW259.27 g/mol
LogP1.07
Rot. Bonds5

About 2-oxopropyl 1-benzyltriazole-4-carboxylate

2-oxopropyl 1-benzyltriazole-4-carboxylate (PubChem CID 55640927) has the molecular formula C13H13N3O3 and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-oxopropyl 1-benzyltriazole-4-carboxylate.

Molecular Properties

Compound Name2-oxopropyl 1-benzyltriazole-4-carboxylate
PubChem CID55640927
Molecular FormulaC13H13N3O3
Molecular Weight259.27 g/mol
Exact Mass259.10
IUPAC Name2-oxopropyl 1-benzyltriazole-4-carboxylate
SMILESCC(=O)COC(=O)c1cn(Cc2ccccc2)nn1
InChIInChI=1S/C13H13N3O3/c1-10(17)9-19-13(18)12-8-16(15-14-12)7-11-5-3-2-4-6-11/h2-6,8H,7,9H2,1H3
InChIKeyHKLSCEBYFZFIMU-UHFFFAOYSA-N
XLogP1.07
TPSA74.08 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.27
LogP ≤ 51.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze 2-oxopropyl 1-benzyltriazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxopropyl 1-benzyltriazole-4-carboxylate?
The IUPAC name of 2-oxopropyl 1-benzyltriazole-4-carboxylate (CID 55640927) is 2-oxopropyl 1-benzyltriazole-4-carboxylate.
What is the SMILES notation for 2-oxopropyl 1-benzyltriazole-4-carboxylate?
The canonical SMILES for 2-oxopropyl 1-benzyltriazole-4-carboxylate is CC(=O)COC(=O)c1cn(Cc2ccccc2)nn1.
What is the InChIKey of 2-oxopropyl 1-benzyltriazole-4-carboxylate?
The InChIKey is HKLSCEBYFZFIMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O3/c1-10(17)9-19-13(18)12-8-16(15-14-12)7-11-5-3-2-4-6-11/h2-6,8H,7,9H2,1H3.
What are the key properties of 2-oxopropyl 1-benzyltriazole-4-carboxylate?
2-oxopropyl 1-benzyltriazole-4-carboxylate has a molecular weight of 259.27 g/mol, XLogP of 1.07, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl 1-benzyltriazole-4-carboxylate is sourced from PubChem (CID 55640927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).