C21H21FN4O3 — CID 55640929
[2-[ethyl-[(3-fluorophenyl)methyl]amino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate (PubChem CID 55640929) has the molecular formula C21H21FN4O3 and a molecular weight of 396.42 g/mol. Its IUPAC name is [2-[ethyl-[(3-fluorophenyl)methyl]amino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate.
| Compound Name | [2-[ethyl-[(3-fluorophenyl)methyl]amino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 55640929 |
| Molecular Formula | C21H21FN4O3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | [2-[ethyl-[(3-fluorophenyl)methyl]amino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)COC(=O)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C21H21FN4O3/c1-2-25(12-17-9-6-10-18(22)11-17)20(27)15-29-21(28)19-14-26(24-23-19)13-16-7-4-3-5-8-16/h3-11,14H,2,12-13,15H2,1H3 |
| InChIKey | ABOBEZQWLYMBEW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |