C17H15Cl2FN2O3 — CID 55397218
[2-[ethyl-[(3-fluorophenyl)methyl]amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 55397218) has the molecular formula C17H15Cl2FN2O3 and a molecular weight of 385.22 g/mol. Its IUPAC name is [2-[ethyl-[(3-fluorophenyl)methyl]amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-[ethyl-[(3-fluorophenyl)methyl]amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 55397218 |
| Molecular Formula | C17H15Cl2FN2O3 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | [2-[ethyl-[(3-fluorophenyl)methyl]amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)COC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2FN2O3/c1-2-22(9-11-4-3-5-13(20)6-11)15(23)10-25-17(24)12-7-14(18)16(19)21-8-12/h3-8H,2,9-10H2,1H3 |
| InChIKey | JDLDAHKYCJCFCR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|