C23H25N5O4 — CID 55640676
[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate (PubChem CID 55640676) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate.
| Compound Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 55640676 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)COC(=O)c2cn(Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C23H25N5O4/c1-3-27(4-2)22(30)18-10-12-19(13-11-18)24-21(29)16-32-23(31)20-15-28(26-25-20)14-17-8-6-5-7-9-17/h5-13,15H,3-4,14,16H2,1-2H3,(H,24,29) |
| InChIKey | QIKYPFNTHZXMDA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |