C22H25N5O5S — CID 55516548
[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate (PubChem CID 55516548) has the molecular formula C22H25N5O5S and a molecular weight of 471.54 g/mol. Its IUPAC name is [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate.
| Compound Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 55516548 |
| Molecular Formula | C22H25N5O5S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)COC(=O)c2cn(Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C22H25N5O5S/c1-3-27(4-2)33(30,31)19-12-10-18(11-13-19)23-21(28)16-32-22(29)20-15-26(25-24-20)14-17-8-6-5-7-9-17/h5-13,15H,3-4,14,16H2,1-2H3,(H,23,28) |
| InChIKey | WPQJYGSIQDYAJG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |