C16H20N4O3 — CID 55516472
[2-(diethylamino)-2-oxoethyl] 1-benzyltriazole-4-carboxylate (PubChem CID 55516472) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 1-benzyltriazole-4-carboxylate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 55516472 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
| SMILES | CCN(CC)C(=O)COC(=O)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C16H20N4O3/c1-3-19(4-2)15(21)12-23-16(22)14-11-20(18-17-14)10-13-8-6-5-7-9-13/h5-9,11H,3-4,10,12H2,1-2H3 |
| InChIKey | LCMQKEPPYXUFFB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |