C23H25N3O3 — CID 8536950
[2-(diethylamino)-2-oxoethyl] 1-benzyl-3-phenylpyrazole-4-carboxylate (PubChem CID 8536950) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 1-benzyl-3-phenylpyrazole-4-carboxylate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] 1-benzyl-3-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 8536950 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 1-benzyl-3-phenylpyrazole-4-carboxylate |
| SMILES | CCN(CC)C(=O)COC(=O)c1cn(Cc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H25N3O3/c1-3-25(4-2)21(27)17-29-23(28)20-16-26(15-18-11-7-5-8-12-18)24-22(20)19-13-9-6-10-14-19/h5-14,16H,3-4,15,17H2,1-2H3 |
| InChIKey | PQLIQAABAMZIMS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |