C21H19N3O4 — CID 8980258
cyanomethyl 1-benzyl-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate (PubChem CID 8980258) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is cyanomethyl 1-benzyl-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate.
| Compound Name | cyanomethyl 1-benzyl-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 8980258 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | cyanomethyl 1-benzyl-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate |
| SMILES | COc1ccc(-c2nn(Cc3ccccc3)cc2C(=O)OCC#N)cc1OC |
| InChI | InChI=1S/C21H19N3O4/c1-26-18-9-8-16(12-19(18)27-2)20-17(21(25)28-11-10-22)14-24(23-20)13-15-6-4-3-5-7-15/h3-9,12,14H,11,13H2,1-2H3 |
| InChIKey | YAIUXOWXJDYDSB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 86.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |