C27H28N4O3 — CID 60602835
(E)-3-[1-benzyl-3-(3,4-dimethoxyphenyl)pyrazol-4-yl]-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 60602835) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is (E)-3-[1-benzyl-3-(3,4-dimethoxyphenyl)pyrazol-4-yl]-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[1-benzyl-3-(3,4-dimethoxyphenyl)pyrazol-4-yl]-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 60602835 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (E)-3-[1-benzyl-3-(3,4-dimethoxyphenyl)pyrazol-4-yl]-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | COc1ccc(-c2nn(Cc3ccccc3)cc2/C=C/C(=O)c2cnn(C(C)C)c2)cc1OC |
| InChI | InChI=1S/C27H28N4O3/c1-19(2)31-18-23(15-28-31)24(32)12-10-22-17-30(16-20-8-6-5-7-9-20)29-27(22)21-11-13-25(33-3)26(14-21)34-4/h5-15,17-19H,16H2,1-4H3/b12-10+ |
| InChIKey | RAYZTSNDBGLBKN-ZRDIBKRKSA-N |
| XLogP | 5.29 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|