C20H17N2O3- — CID 2526128
(E)-3-[1-benzyl-3-(2-methoxyphenyl)pyrazol-4-yl]prop-2-enoate (PubChem CID 2526128) has the molecular formula C20H17N2O3- and a molecular weight of 333.37 g/mol. Its IUPAC name is (E)-3-[1-benzyl-3-(2-methoxyphenyl)pyrazol-4-yl]prop-2-enoate.
| Compound Name | (E)-3-[1-benzyl-3-(2-methoxyphenyl)pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2526128 |
| Molecular Formula | C20H17N2O3- |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (E)-3-[1-benzyl-3-(2-methoxyphenyl)pyrazol-4-yl]prop-2-enoate |
| SMILES | COc1ccccc1-c1nn(Cc2ccccc2)cc1/C=C/C(=O)[O-] |
| InChI | InChI=1S/C20H18N2O3/c1-25-18-10-6-5-9-17(18)20-16(11-12-19(23)24)14-22(21-20)13-15-7-3-2-4-8-15/h2-12,14H,13H2,1H3,(H,23,24)/p-1/b12-11+ |
| InChIKey | WDLBGYAIDUCZMC-VAWYXSNFSA-M |
| XLogP | 2.37 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|