C29H23N3O5 — CID 17429834
2-[(4Z)-4-[[1-benzyl-3-(2-methoxyphenyl)pyrazol-4-yl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetic acid (PubChem CID 17429834) has the molecular formula C29H23N3O5 and a molecular weight of 493.52 g/mol. Its IUPAC name is 2-[(4Z)-4-[[1-benzyl-3-(2-methoxyphenyl)pyrazol-4-yl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetic acid.
| Compound Name | 2-[(4Z)-4-[[1-benzyl-3-(2-methoxyphenyl)pyrazol-4-yl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 17429834 |
| Molecular Formula | C29H23N3O5 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2-[(4Z)-4-[[1-benzyl-3-(2-methoxyphenyl)pyrazol-4-yl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetic acid |
| SMILES | COc1ccccc1-c1nn(Cc2ccccc2)cc1/C=C1\C(=O)N(CC(=O)O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C29H23N3O5/c1-37-25-14-8-7-13-23(25)27-20(17-31(30-27)16-19-9-3-2-4-10-19)15-24-21-11-5-6-12-22(21)28(35)32(29(24)36)18-26(33)34/h2-15,17H,16,18H2,1H3,(H,33,34)/b24-15- |
| InChIKey | SQQYBUUOYGUOIC-IWIPYMOSSA-N |
| XLogP | 4.21 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|