C24H17NO4 — CID 9367828
2-[(4Z)-1,3-dioxo-4-[(4-phenylphenyl)methylidene]isoquinolin-2-yl]acetic acid (PubChem CID 9367828) has the molecular formula C24H17NO4 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-[(4Z)-1,3-dioxo-4-[(4-phenylphenyl)methylidene]isoquinolin-2-yl]acetic acid.
| Compound Name | 2-[(4Z)-1,3-dioxo-4-[(4-phenylphenyl)methylidene]isoquinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 9367828 |
| Molecular Formula | C24H17NO4 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-[(4Z)-1,3-dioxo-4-[(4-phenylphenyl)methylidene]isoquinolin-2-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C\c2ccc(-c3ccccc3)cc2)c2ccccc2C1=O |
| InChI | InChI=1S/C24H17NO4/c26-22(27)15-25-23(28)20-9-5-4-8-19(20)21(24(25)29)14-16-10-12-18(13-11-16)17-6-2-1-3-7-17/h1-14H,15H2,(H,26,27)/b21-14- |
| InChIKey | IJEMGRRSMKAIRF-STZFKDTASA-N |
| XLogP | 3.96 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|