C18H11BrFNO4 — CID 9367972
2-[(4Z)-4-[(5-bromo-2-fluorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetic acid (PubChem CID 9367972) has the molecular formula C18H11BrFNO4 and a molecular weight of 404.19 g/mol. Its IUPAC name is 2-[(4Z)-4-[(5-bromo-2-fluorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetic acid.
| Compound Name | 2-[(4Z)-4-[(5-bromo-2-fluorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 9367972 |
| Molecular Formula | C18H11BrFNO4 |
| Molecular Weight | 404.19 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 2-[(4Z)-4-[(5-bromo-2-fluorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C\c2cc(Br)ccc2F)c2ccccc2C1=O |
| InChI | InChI=1S/C18H11BrFNO4/c19-11-5-6-15(20)10(7-11)8-14-12-3-1-2-4-13(12)17(24)21(18(14)25)9-16(22)23/h1-8H,9H2,(H,22,23)/b14-8- |
| InChIKey | HRXUGYKECXKWNK-ZSOIEALJSA-N |
| XLogP | 3.20 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|