C26H23BrFNO2 — CID 126116448
(3Z)-3-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1-(2-methylpropyl)indol-2-one (PubChem CID 126116448) has the molecular formula C26H23BrFNO2 and a molecular weight of 480.38 g/mol. Its IUPAC name is (3Z)-3-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1-(2-methylpropyl)indol-2-one.
| Compound Name | (3Z)-3-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1-(2-methylpropyl)indol-2-one |
|---|---|
| PubChem CID | 126116448 |
| Molecular Formula | C26H23BrFNO2 |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | (3Z)-3-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1-(2-methylpropyl)indol-2-one |
| SMILES | CC(C)CN1C(=O)/C(=C\c2cc(Br)ccc2OCc2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C26H23BrFNO2/c1-17(2)15-29-24-10-6-4-8-21(24)22(26(29)30)14-19-13-20(27)11-12-25(19)31-16-18-7-3-5-9-23(18)28/h3-14,17H,15-16H2,1-2H3/b22-14- |
| InChIKey | RTHXOSXBCHSIAX-HMAPJEAMSA-N |
| XLogP | 6.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|