C30H26BrNO2 — CID 126125228
(3Z)-3-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1-(2-methylpropyl)indol-2-one (PubChem CID 126125228) has the molecular formula C30H26BrNO2 and a molecular weight of 512.45 g/mol. Its IUPAC name is (3Z)-3-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1-(2-methylpropyl)indol-2-one.
| Compound Name | (3Z)-3-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1-(2-methylpropyl)indol-2-one |
|---|---|
| PubChem CID | 126125228 |
| Molecular Formula | C30H26BrNO2 |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | (3Z)-3-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1-(2-methylpropyl)indol-2-one |
| SMILES | CC(C)CN1C(=O)/C(=C\c2ccc(OCc3ccc4ccccc4c3)c(Br)c2)c2ccccc21 |
| InChI | InChI=1S/C30H26BrNO2/c1-20(2)18-32-28-10-6-5-9-25(28)26(30(32)33)16-21-12-14-29(27(31)17-21)34-19-22-11-13-23-7-3-4-8-24(23)15-22/h3-17,20H,18-19H2,1-2H3/b26-16- |
| InChIKey | QLUZBNMDNCPMIQ-QQXSKIMKSA-N |
| XLogP | 7.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|