C25H20BrCl2NO2 — CID 126126074
(3Z)-3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-propylindol-2-one (PubChem CID 126126074) has the molecular formula C25H20BrCl2NO2 and a molecular weight of 517.25 g/mol. Its IUPAC name is (3Z)-3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-propylindol-2-one.
| Compound Name | (3Z)-3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-propylindol-2-one |
|---|---|
| PubChem CID | 126126074 |
| Molecular Formula | C25H20BrCl2NO2 |
| Molecular Weight | 517.25 g/mol |
| Exact Mass | 515.01 |
| IUPAC Name | (3Z)-3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-propylindol-2-one |
| SMILES | CCCN1C(=O)/C(=C\c2ccc(OCc3ccc(Cl)cc3Cl)c(Br)c2)c2ccccc21 |
| InChI | InChI=1S/C25H20BrCl2NO2/c1-2-11-29-23-6-4-3-5-19(23)20(25(29)30)12-16-7-10-24(21(26)13-16)31-15-17-8-9-18(27)14-22(17)28/h3-10,12-14H,2,11,15H2,1H3/b20-12- |
| InChIKey | SVQSWESYNOTMBY-NDENLUEZSA-N |
| XLogP | 7.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.25 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|