C30H27BrCl2N2O6 — CID 126194897
(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126194897) has the molecular formula C30H27BrCl2N2O6 and a molecular weight of 662.36 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126194897 |
| Molecular Formula | C30H27BrCl2N2O6 |
| Molecular Weight | 662.36 g/mol |
| Exact Mass | 660.04 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3ccc(OCc4ccc(Cl)cc4Cl)c(Br)c3)C2=O)cc1OCC |
| InChI | InChI=1S/C30H27BrCl2N2O6/c1-3-11-40-26-10-6-19(14-27(26)39-4-2)16-35-29(37)22(28(36)34-30(35)38)12-18-5-9-25(23(31)13-18)41-17-20-7-8-21(32)15-24(20)33/h5-10,12-15H,3-4,11,16-17H2,1-2H3,(H,34,36,38)/b22-12+ |
| InChIKey | JEPVPMVSLIKNOR-WSDLNYQXSA-N |
| XLogP | 7.18 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.36 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|