C29H25Br2ClN2O6 — CID 126131444
(5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126131444) has the molecular formula C29H25Br2ClN2O6 and a molecular weight of 692.79 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126131444 |
| Molecular Formula | C29H25Br2ClN2O6 |
| Molecular Weight | 692.79 g/mol |
| Exact Mass | 689.98 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3cc(Br)c(OCc4ccccc4Cl)c(Br)c3)C2=O)cc1OC |
| InChI | InChI=1S/C29H25Br2ClN2O6/c1-3-10-39-24-9-8-17(14-25(24)38-2)15-34-28(36)20(27(35)33-29(34)37)11-18-12-21(30)26(22(31)13-18)40-16-19-6-4-5-7-23(19)32/h4-9,11-14H,3,10,15-16H2,1-2H3,(H,33,35,37)/b20-11+ |
| InChIKey | MPDYXXMAWNPPRN-RGVLZGJSSA-N |
| XLogP | 6.90 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.79 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|