C25H27BrN2O6 — CID 126144872
(5E)-5-[(3-bromo-4-propoxyphenyl)methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126144872) has the molecular formula C25H27BrN2O6 and a molecular weight of 531.40 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4-propoxyphenyl)methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(3-bromo-4-propoxyphenyl)methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126144872 |
| Molecular Formula | C25H27BrN2O6 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | (5E)-5-[(3-bromo-4-propoxyphenyl)methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(/C=C2\C(=O)NC(=O)N(Cc3ccc(OCCC)c(OC)c3)C2=O)cc1Br |
| InChI | InChI=1S/C25H27BrN2O6/c1-4-10-33-20-8-6-16(13-19(20)26)12-18-23(29)27-25(31)28(24(18)30)15-17-7-9-21(34-11-5-2)22(14-17)32-3/h6-9,12-14H,4-5,10-11,15H2,1-3H3,(H,27,29,31)/b18-12+ |
| InChIKey | DZQSVAMLWCYGEE-LDADJPATSA-N |
| XLogP | 4.70 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|