C28H24BrClN2O8S — CID 126150778
[2-bromo-4-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126150778) has the molecular formula C28H24BrClN2O8S and a molecular weight of 663.93 g/mol. Its IUPAC name is [2-bromo-4-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-bromo-4-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126150778 |
| Molecular Formula | C28H24BrClN2O8S |
| Molecular Weight | 663.93 g/mol |
| Exact Mass | 662.01 |
| IUPAC Name | [2-bromo-4-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3ccc(OS(=O)(=O)c4ccc(Cl)cc4)c(Br)c3)C2=O)cc1OC |
| InChI | InChI=1S/C28H24BrClN2O8S/c1-3-12-39-24-11-5-18(15-25(24)38-2)16-32-27(34)21(26(33)31-28(32)35)13-17-4-10-23(22(29)14-17)40-41(36,37)20-8-6-19(30)7-9-20/h4-11,13-15H,3,12,16H2,1-2H3,(H,31,33,35)/b21-13+ |
| InChIKey | ODVKRBCYNADRDN-FYJGNVAPSA-N |
| XLogP | 5.33 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|