C29H26Br2N2O8S — CID 126147638
[2,4-dibromo-6-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126147638) has the molecular formula C29H26Br2N2O8S and a molecular weight of 722.41 g/mol. Its IUPAC name is [2,4-dibromo-6-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2,4-dibromo-6-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126147638 |
| Molecular Formula | C29H26Br2N2O8S |
| Molecular Weight | 722.41 g/mol |
| Exact Mass | 719.98 |
| IUPAC Name | [2,4-dibromo-6-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3cc(Br)cc(Br)c3OS(=O)(=O)c3ccc(C)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C29H26Br2N2O8S/c1-4-11-40-24-10-7-18(12-25(24)39-3)16-33-28(35)22(27(34)32-29(33)36)14-19-13-20(30)15-23(31)26(19)41-42(37,38)21-8-5-17(2)6-9-21/h5-10,12-15H,4,11,16H2,1-3H3,(H,32,34,36)/b22-14+ |
| InChIKey | HTJXDGLDLZUYJB-HYARGMPZSA-N |
| XLogP | 5.75 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.41 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|