C28H25BrN2O8S — CID 126138049
[4-bromo-2-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate (PubChem CID 126138049) has the molecular formula C28H25BrN2O8S and a molecular weight of 629.49 g/mol. Its IUPAC name is [4-bromo-2-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [4-bromo-2-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126138049 |
| Molecular Formula | C28H25BrN2O8S |
| Molecular Weight | 629.49 g/mol |
| Exact Mass | 628.05 |
| IUPAC Name | [4-bromo-2-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3cc(Br)ccc3OS(=O)(=O)c3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C28H25BrN2O8S/c1-3-13-38-24-11-9-18(14-25(24)37-2)17-31-27(33)22(26(32)30-28(31)34)16-19-15-20(29)10-12-23(19)39-40(35,36)21-7-5-4-6-8-21/h4-12,14-16H,3,13,17H2,1-2H3,(H,30,32,34)/b22-16+ |
| InChIKey | XWKCTZKJEDQYAW-CJLVFECKSA-N |
| XLogP | 4.68 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|